2-Bromo-5-fluorobenzyl alcohol
Catalog No: FT-0652763
CAS No: 202865-66-5
- Chemical Name: 2-Bromo-5-fluorobenzyl alcohol
- Molecular Formula: C7H6BrFO
- Molecular Weight: 205.02
- InChI Key: HXGZPMHPSBJMKB-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6BrFO/c8-7-2-1-6(9)3-5(7)4-10/h1-3,10H,4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 205.024 |
| Density: | 1.7±0.1 g/cm3 |
| CAS: | 202865-66-5 |
| Bolling_Point: | 252.5±25.0 °C at 760 mmHg |
| Product_Name: | (2-Bromo-5-fluorophenyl)methanol |
| Melting_Point: | 91-94ºC |
| Flash_Point: | 106.5±23.2 °C |
| MF: | C7H6BrFO |
| Density: | 1.7±0.1 g/cm3 |
|---|---|
| LogP: | 1.79 |
| Flash_Point: | 106.5±23.2 °C |
| Melting_Point: | 91-94ºC |
| FW: | 205.024 |
| PSA: | 20.23000 |
| Exact_Mass: | 203.958603 |
| MF: | C7H6BrFO |
| Bolling_Point: | 252.5±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.567 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn:Harmful; |
| Risk_Statements(EU): | R22;R36 |
| Safety_Statements: | S26-S36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)